C19H21ClN2O — CID 53251733
3-chloro-N-[4-(2-pyrrolidin-2-ylethyl)phenyl]benzamide (PubChem CID 53251733) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is 3-chloro-N-[4-(2-pyrrolidin-2-ylethyl)phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-(2-pyrrolidin-2-ylethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 53251733 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-chloro-N-[4-(2-pyrrolidin-2-ylethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CCC2CCCN2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O/c20-16-4-1-3-15(13-16)19(23)22-18-10-7-14(8-11-18)6-9-17-5-2-12-21-17/h1,3-4,7-8,10-11,13,17,21H,2,5-6,9,12H2,(H,22,23) |
| InChIKey | KGNFUKAKSJPFKX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |