About 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate
2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate (PubChem CID 53251848) has the molecular formula C9H19NOS2
and a molecular weight of 221.39 g/mol. Its IUPAC name is 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate |
| PubChem CID | 53251848 |
| Molecular Formula | C9H19NOS2 |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate |
| SMILES | CC(C)N(C(=S)SCCO)C(C)C |
| InChI | InChI=1S/C9H19NOS2/c1-7(2)10(8(3)4)9(12)13-6-5-11/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | UNJJIWNZMFWXAR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate?
The IUPAC name of 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate (CID 53251848) is 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate.
What is the SMILES notation for 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate?
The canonical SMILES for 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate is CC(C)N(C(=S)SCCO)C(C)C.
What is the InChIKey of 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate?
The InChIKey is UNJJIWNZMFWXAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOS2/c1-7(2)10(8(3)4)9(12)13-6-5-11/h7-8,11H,5-6H2,1-4H3.
What are the key properties of 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate?
2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate has a molecular weight of 221.39 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N,N-di(propan-2-yl)carbamodithioate is sourced from PubChem (CID 53251848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).