C18H20N6 — CID 53251988
13-[[(3S)-1-ethylpiperidin-3-yl]amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 53251988) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 13-[[(3S)-1-ethylpiperidin-3-yl]amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 13-[[(3S)-1-ethylpiperidin-3-yl]amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 53251988 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 13-[[(3S)-1-ethylpiperidin-3-yl]amino]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | CCN1CCC[C@H](Nc2ccnc3[nH]c4cnc(C#N)cc4c23)C1 |
| InChI | InChI=1S/C18H20N6/c1-2-24-7-3-4-12(11-24)22-15-5-6-20-18-17(15)14-8-13(9-19)21-10-16(14)23-18/h5-6,8,10,12H,2-4,7,11H2,1H3,(H2,20,22,23)/t12-/m0/s1 |
| InChIKey | CHZAGFSULAWPKQ-LBPRGKRZSA-N |
| XLogP | 2.88 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |