C13H16N2O3 — CID 5325219
methyl (1S,2R,4R)-4-cyano-2-(2-cyanoethyl)-1,2-dimethyl-3-oxocyclopentane-1-carboxylate (PubChem CID 5325219) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl (1S,2R,4R)-4-cyano-2-(2-cyanoethyl)-1,2-dimethyl-3-oxocyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2R,4R)-4-cyano-2-(2-cyanoethyl)-1,2-dimethyl-3-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 5325219 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl (1S,2R,4R)-4-cyano-2-(2-cyanoethyl)-1,2-dimethyl-3-oxocyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@H](C#N)C(=O)[C@]1(C)CCC#N |
| InChI | InChI=1S/C13H16N2O3/c1-12(5-4-6-14)10(16)9(8-15)7-13(12,2)11(17)18-3/h9H,4-5,7H2,1-3H3/t9-,12+,13-/m1/s1 |
| InChIKey | WIRRDMDKRGEHSP-JIMOISOXSA-N |
| XLogP | 1.59 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|