C22H18Cl2F3N3O2S — CID 53252790
5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2-methylsulfanylethyl)indolizine-8-carboxamide (PubChem CID 53252790) has the molecular formula C22H18Cl2F3N3O2S and a molecular weight of 516.37 g/mol. Its IUPAC name is 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2-methylsulfanylethyl)indolizine-8-carboxamide.
| Compound Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2-methylsulfanylethyl)indolizine-8-carboxamide |
|---|---|
| PubChem CID | 53252790 |
| Molecular Formula | C22H18Cl2F3N3O2S |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2-methylsulfanylethyl)indolizine-8-carboxamide |
| SMILES | CSCCNC(=O)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)n2cccc12 |
| InChI | InChI=1S/C22H18Cl2F3N3O2S/c1-33-8-6-28-20(31)16-4-5-19(30-7-2-3-18(16)30)17-12-21(32-29-17,22(25,26)27)13-9-14(23)11-15(24)10-13/h2-5,7,9-11H,6,8,12H2,1H3,(H,28,31) |
| InChIKey | IQEQIZLMCAQWHR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|