C23H17Cl2F6N3O2 — CID 53252836
5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)indolizine-8-carboxamide (PubChem CID 53252836) has the molecular formula C23H17Cl2F6N3O2 and a molecular weight of 552.30 g/mol. Its IUPAC name is 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)indolizine-8-carboxamide.
| Compound Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)indolizine-8-carboxamide |
|---|---|
| PubChem CID | 53252836 |
| Molecular Formula | C23H17Cl2F6N3O2 |
| Molecular Weight | 552.30 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)indolizine-8-carboxamide |
| SMILES | Cc1cc(C)n2c(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)ccc(C(=O)NCC(F)(F)F)c12 |
| InChI | InChI=1S/C23H17Cl2F6N3O2/c1-11-5-12(2)34-18(4-3-16(19(11)34)20(35)32-10-22(26,27)28)17-9-21(36-33-17,23(29,30)31)13-6-14(24)8-15(25)7-13/h3-8H,9-10H2,1-2H3,(H,32,35) |
| InChIKey | BUPKZZUXVLRVMH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.30 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |