C16H34O2Si2 — CID 53252931
trimethyl-(3,3,6,6-tetramethyl-2-trimethylsilyloxycyclohexen-1-yl)oxysilane (PubChem CID 53252931) has the molecular formula C16H34O2Si2 and a molecular weight of 314.62 g/mol. Its IUPAC name is trimethyl-(3,3,6,6-tetramethyl-2-trimethylsilyloxycyclohexen-1-yl)oxysilane.
| Compound Name | trimethyl-(3,3,6,6-tetramethyl-2-trimethylsilyloxycyclohexen-1-yl)oxysilane |
|---|---|
| PubChem CID | 53252931 |
| Molecular Formula | C16H34O2Si2 |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | trimethyl-(3,3,6,6-tetramethyl-2-trimethylsilyloxycyclohexen-1-yl)oxysilane |
| SMILES | CC1(C)CCC(C)(C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O2Si2/c1-15(2)11-12-16(3,4)14(18-20(8,9)10)13(15)17-19(5,6)7/h11-12H2,1-10H3 |
| InChIKey | MBIPVNWWPMPFLM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|