C20H29NO7S — CID 53253659
2-[(3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-dioxo-1,4-thiazinan-4-yl]ethanol (PubChem CID 53253659) has the molecular formula C20H29NO7S and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-[(3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-dioxo-1,4-thiazinan-4-yl]ethanol.
| Compound Name | 2-[(3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-dioxo-1,4-thiazinan-4-yl]ethanol |
|---|---|
| PubChem CID | 53253659 |
| Molecular Formula | C20H29NO7S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-[(3R)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-dioxo-1,4-thiazinan-4-yl]ethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H]3CS(=O)(=O)CCN3CCO)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C20H29NO7S/c1-20(2)27-18-17(25-12-14-6-4-3-5-7-14)16(26-19(18)28-20)15-13-29(23,24)11-9-21(15)8-10-22/h3-7,15-19,22H,8-13H2,1-2H3/t15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | YUAOFMYZCJWHMR-ZWJWXYIHSA-N |
| XLogP | 0.54 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |