About 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile
5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile (PubChem CID 5325387) has the molecular formula C9H5N3O2
and a molecular weight of 187.16 g/mol. Its IUPAC name is 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile.
Molecular Properties
| Compound Name | 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile |
| PubChem CID | 5325387 |
| Molecular Formula | C9H5N3O2 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile |
| SMILES | N#Cc1no[n+]([O-])c1-c1ccccc1 |
| InChI | InChI=1S/C9H5N3O2/c10-6-8-9(12(13)14-11-8)7-4-2-1-3-5-7/h1-5H |
| InChIKey | WJOXYPNQASUCHB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile?
The IUPAC name of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile (CID 5325387) is 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile.
What is the SMILES notation for 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile?
The canonical SMILES for 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile is N#Cc1no[n+]([O-])c1-c1ccccc1.
What is the InChIKey of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile?
The InChIKey is WJOXYPNQASUCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O2/c10-6-8-9(12(13)14-11-8)7-4-2-1-3-5-7/h1-5H.
What are the key properties of 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile?
5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile has a molecular weight of 187.16 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxido-4-phenyl-1,2,5-oxadiazol-5-ium-3-carbonitrile is sourced from PubChem (CID 5325387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).