C28H36O5SSi — CID 53253877
[1-[3-[tert-butyl(dimethyl)silyl]oxycyclohexa-1,3-dien-1-yl]cyclohexa-2,5-dien-1-yl]methyl (E)-3-(benzenesulfonyl)prop-2-enoate (PubChem CID 53253877) has the molecular formula C28H36O5SSi and a molecular weight of 512.74 g/mol. Its IUPAC name is [1-[3-[tert-butyl(dimethyl)silyl]oxycyclohexa-1,3-dien-1-yl]cyclohexa-2,5-dien-1-yl]methyl (E)-3-(benzenesulfonyl)prop-2-enoate.
| Compound Name | [1-[3-[tert-butyl(dimethyl)silyl]oxycyclohexa-1,3-dien-1-yl]cyclohexa-2,5-dien-1-yl]methyl (E)-3-(benzenesulfonyl)prop-2-enoate |
|---|---|
| PubChem CID | 53253877 |
| Molecular Formula | C28H36O5SSi |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | [1-[3-[tert-butyl(dimethyl)silyl]oxycyclohexa-1,3-dien-1-yl]cyclohexa-2,5-dien-1-yl]methyl (E)-3-(benzenesulfonyl)prop-2-enoate |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CCCC(C2(COC(=O)/C=C/S(=O)(=O)c3ccccc3)C=CCC=C2)=C1 |
| InChI | InChI=1S/C28H36O5SSi/c1-27(2,3)35(4,5)33-24-14-12-13-23(21-24)28(18-10-7-11-19-28)22-32-26(29)17-20-34(30,31)25-15-8-6-9-16-25/h6,8-11,14-21H,7,12-13,22H2,1-5H3/b20-17+ |
| InChIKey | VWGNOTPXHWPMPV-LVZFUZTISA-N |
| XLogP | 6.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|