C5H10O3S — CID 5325388
(3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-one (PubChem CID 5325388) has the molecular formula C5H10O3S and a molecular weight of 150.20 g/mol. Its IUPAC name is (3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-one.
| Compound Name | (3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-one |
|---|---|
| PubChem CID | 5325388 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (3S)-1,3-dihydroxy-4-methylsulfanylbutan-2-one |
| SMILES | CSC[C@@H](O)C(=O)CO |
| InChI | InChI=1S/C5H10O3S/c1-9-3-5(8)4(7)2-6/h5-6,8H,2-3H2,1H3/t5-/m1/s1 |
| InChIKey | BESLDDAIKHRHBA-RXMQYKEDSA-N |
| XLogP | -0.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |