About (4-cyanophenyl) 3-methoxybenzoate
(4-cyanophenyl) 3-methoxybenzoate (PubChem CID 532539) has the molecular formula C15H11NO3
and a molecular weight of 253.26 g/mol. Its IUPAC name is (4-cyanophenyl) 3-methoxybenzoate.
Molecular Properties
| Compound Name | (4-cyanophenyl) 3-methoxybenzoate |
| PubChem CID | 532539 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4-cyanophenyl) 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C15H11NO3/c1-18-14-4-2-3-12(9-14)15(17)19-13-7-5-11(10-16)6-8-13/h2-9H,1H3 |
| InChIKey | MWYWRFBEFDEXRC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 3-methoxybenzoate?
The IUPAC name of (4-cyanophenyl) 3-methoxybenzoate (CID 532539) is (4-cyanophenyl) 3-methoxybenzoate.
What is the SMILES notation for (4-cyanophenyl) 3-methoxybenzoate?
The canonical SMILES for (4-cyanophenyl) 3-methoxybenzoate is COc1cccc(C(=O)Oc2ccc(C#N)cc2)c1.
What is the InChIKey of (4-cyanophenyl) 3-methoxybenzoate?
The InChIKey is MWYWRFBEFDEXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3/c1-18-14-4-2-3-12(9-14)15(17)19-13-7-5-11(10-16)6-8-13/h2-9H,1H3.
What are the key properties of (4-cyanophenyl) 3-methoxybenzoate?
(4-cyanophenyl) 3-methoxybenzoate has a molecular weight of 253.26 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 3-methoxybenzoate is sourced from PubChem (CID 532539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).