C8H14O3S — CID 5325397
ethyl (2R,6S)-6-methyl-1,3-oxathiane-2-carboxylate (PubChem CID 5325397) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is ethyl (2R,6S)-6-methyl-1,3-oxathiane-2-carboxylate.
| Compound Name | ethyl (2R,6S)-6-methyl-1,3-oxathiane-2-carboxylate |
|---|---|
| PubChem CID | 5325397 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | ethyl (2R,6S)-6-methyl-1,3-oxathiane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@@H](C)CCS1 |
| InChI | InChI=1S/C8H14O3S/c1-3-10-7(9)8-11-6(2)4-5-12-8/h6,8H,3-5H2,1-2H3/t6-,8+/m0/s1 |
| InChIKey | XZZTYXYTDTVYTH-POYBYMJQSA-N |
| XLogP | 1.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |