About tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate
tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (PubChem CID 53254228) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| PubChem CID | 53254228 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2C=C[C@]1(CO)CC2 |
| InChI | InChI=1S/C12H19NO3/c1-11(2,3)16-10(15)13-9-4-6-12(13,8-14)7-5-9/h4,6,9,14H,5,7-8H2,1-3H3/t9-,12+/m0/s1 |
| InChIKey | VHIMISGRACEXPB-JOYOIKCWSA-N |
| XLogP | 1.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate?
The IUPAC name of tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (CID 53254228) is tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
What is the SMILES notation for tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate?
The canonical SMILES for tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate is CC(C)(C)OC(=O)N1[C@H]2C=C[C@]1(CO)CC2.
What is the InChIKey of tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate?
The InChIKey is VHIMISGRACEXPB-JOYOIKCWSA-N. The full InChI is InChI=1S/C12H19NO3/c1-11(2,3)16-10(15)13-9-4-6-12(13,8-14)7-5-9/h4,6,9,14H,5,7-8H2,1-3H3/t9-,12+/m0/s1.
What are the key properties of tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate?
tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate has a molecular weight of 225.29 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1S,4R)-1-(hydroxymethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate is sourced from PubChem (CID 53254228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).