C19H21N3 — CID 53254471
N-cyclohexyl-1-phenylbenzimidazol-2-amine (PubChem CID 53254471) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-cyclohexyl-1-phenylbenzimidazol-2-amine.
| Compound Name | N-cyclohexyl-1-phenylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 53254471 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-cyclohexyl-1-phenylbenzimidazol-2-amine |
| SMILES | c1ccc(-n2c(NC3CCCCC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N3/c1-3-9-15(10-4-1)20-19-21-17-13-7-8-14-18(17)22(19)16-11-5-2-6-12-16/h2,5-8,11-15H,1,3-4,9-10H2,(H,20,21) |
| InChIKey | HZHRMDKEWICYKC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |