C15H22N2O3 — CID 53254516
tert-butyl (1S,4R)-1-(prop-2-enylcarbamoyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (PubChem CID 53254516) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is tert-butyl (1S,4R)-1-(prop-2-enylcarbamoyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
| Compound Name | tert-butyl (1S,4R)-1-(prop-2-enylcarbamoyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 53254516 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | tert-butyl (1S,4R)-1-(prop-2-enylcarbamoyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| SMILES | C=CCNC(=O)[C@@]12C=C[C@@H](CC1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O3/c1-5-10-16-12(18)15-8-6-11(7-9-15)17(15)13(19)20-14(2,3)4/h5-6,8,11H,1,7,9-10H2,2-4H3,(H,16,18)/t11-,15+/m0/s1 |
| InChIKey | XYWTUQMIXRYVKP-XHDPSFHLSA-N |
| XLogP | 2.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|