About 2-benzyltriazole
2-benzyltriazole (PubChem CID 5325467) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-benzyltriazole.
Molecular Properties
| Compound Name | 2-benzyltriazole |
| PubChem CID | 5325467 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2-benzyltriazole |
| SMILES | c1ccc(Cn2nccn2)cc1 |
| InChI | InChI=1S/C9H9N3/c1-2-4-9(5-3-1)8-12-10-6-7-11-12/h1-7H,8H2 |
| InChIKey | RZHLLJGGWPZWHH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyltriazole?
The IUPAC name of 2-benzyltriazole (CID 5325467) is 2-benzyltriazole.
What is the SMILES notation for 2-benzyltriazole?
The canonical SMILES for 2-benzyltriazole is c1ccc(Cn2nccn2)cc1.
What is the InChIKey of 2-benzyltriazole?
The InChIKey is RZHLLJGGWPZWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c1-2-4-9(5-3-1)8-12-10-6-7-11-12/h1-7H,8H2.
What are the key properties of 2-benzyltriazole?
2-benzyltriazole has a molecular weight of 159.19 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyltriazole is sourced from PubChem (CID 5325467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).