(E)-3-ethoxyprop-2-enoyl chloride

C5H7ClO2 — CID 5325500

IUPAC(E)-3-ethoxyprop-2-enoyl chloride
SMILESCCO/C=C/C(=O)Cl
InChIInChI=1S/C5H7ClO2/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3/b4-3+
InChIKeySFMFACMIOWQIPR-ONEGZZNKSA-N
MW134.56 g/mol
LogP1.30
Rot. Bonds3

About (E)-3-ethoxyprop-2-enoyl chloride

(E)-3-ethoxyprop-2-enoyl chloride (PubChem CID 5325500) has the molecular formula C5H7ClO2 and a molecular weight of 134.56 g/mol. Its IUPAC name is (E)-3-ethoxyprop-2-enoyl chloride.

Molecular Properties

Compound Name(E)-3-ethoxyprop-2-enoyl chloride
PubChem CID5325500
Molecular FormulaC5H7ClO2
Molecular Weight134.56 g/mol
Exact Mass134.01
IUPAC Name(E)-3-ethoxyprop-2-enoyl chloride
SMILESCCO/C=C/C(=O)Cl
InChIInChI=1S/C5H7ClO2/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3/b4-3+
InChIKeySFMFACMIOWQIPR-ONEGZZNKSA-N
XLogP1.30
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.56
LogP ≤ 51.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-ethoxyprop-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-ethoxyprop-2-enoyl chloride?
The IUPAC name of (E)-3-ethoxyprop-2-enoyl chloride (CID 5325500) is (E)-3-ethoxyprop-2-enoyl chloride.
What is the SMILES notation for (E)-3-ethoxyprop-2-enoyl chloride?
The canonical SMILES for (E)-3-ethoxyprop-2-enoyl chloride is CCO/C=C/C(=O)Cl.
What is the InChIKey of (E)-3-ethoxyprop-2-enoyl chloride?
The InChIKey is SFMFACMIOWQIPR-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3/b4-3+.
What are the key properties of (E)-3-ethoxyprop-2-enoyl chloride?
(E)-3-ethoxyprop-2-enoyl chloride has a molecular weight of 134.56 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethoxyprop-2-enoyl chloride is sourced from PubChem (CID 5325500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).