C36H30F3N5O2 — CID 53255044
2-[[4-(trifluoromethyl)phenyl]iminohydrazinylidene]-1,3-bis(2,4,6-trimethylphenyl)benzo[f]benzimidazole-4,9-dione (PubChem CID 53255044) has the molecular formula C36H30F3N5O2 and a molecular weight of 621.66 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenyl]iminohydrazinylidene]-1,3-bis(2,4,6-trimethylphenyl)benzo[f]benzimidazole-4,9-dione.
| Compound Name | 2-[[4-(trifluoromethyl)phenyl]iminohydrazinylidene]-1,3-bis(2,4,6-trimethylphenyl)benzo[f]benzimidazole-4,9-dione |
|---|---|
| PubChem CID | 53255044 |
| Molecular Formula | C36H30F3N5O2 |
| Molecular Weight | 621.66 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenyl]iminohydrazinylidene]-1,3-bis(2,4,6-trimethylphenyl)benzo[f]benzimidazole-4,9-dione |
| SMILES | Cc1cc(C)c(-n2c3c(n(-c4c(C)cc(C)cc4C)c2=N/N=N/c2ccc(C(F)(F)F)cc2)C(=O)c2ccccc2C3=O)c(C)c1 |
| InChI | InChI=1S/C36H30F3N5O2/c1-19-15-21(3)29(22(4)16-19)43-31-32(34(46)28-10-8-7-9-27(28)33(31)45)44(30-23(5)17-20(2)18-24(30)6)35(43)41-42-40-26-13-11-25(12-14-26)36(37,38)39/h7-18H,1-6H3/b42-40+ |
| InChIKey | KMULNDGCYULAKJ-MZBAEZDSSA-N |
| XLogP | 8.51 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.66 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|