C29H42N2O4 — CID 53255264
methyl (E)-4-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]-4-oxobut-2-enoate (PubChem CID 53255264) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is methyl (E)-4-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 53255264 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | methyl (E)-4-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylamino]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C29H42N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(32)30-25-26-31-28(33)23-24-29(34)35-2/h4-5,7-8,10-11,13-14,16-17,19-20,23-24H,3,6,9,12,15,18,21-22,25-26H2,1-2H3,(H,30,32)(H,31,33)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,24-23+ |
| InChIKey | JQWOXDLIUQYPEM-CKDYJQHLSA-N |
| XLogP | 5.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|