About tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane
tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane (PubChem CID 53255459) has the molecular formula C16H23Br2IO3Si
and a molecular weight of 578.16 g/mol. Its IUPAC name is tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane |
| PubChem CID | 53255459 |
| Molecular Formula | C16H23Br2IO3Si |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 575.88 |
| IUPAC Name | tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane |
| SMILES | COCOc1cc(I)c(C=C(Br)Br)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H23Br2IO3Si/c1-16(2,3)23(5,6)22-14-7-11(8-15(17)18)12(19)9-13(14)21-10-20-4/h7-9H,10H2,1-6H3 |
| InChIKey | LWJKLDFCNFXHDG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane (CID 53255459) is tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane is COCOc1cc(I)c(C=C(Br)Br)cc1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane?
The InChIKey is LWJKLDFCNFXHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Br2IO3Si/c1-16(2,3)23(5,6)22-14-7-11(8-15(17)18)12(19)9-13(14)21-10-20-4/h7-9H,10H2,1-6H3.
What are the key properties of tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane?
tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane has a molecular weight of 578.16 g/mol, XLogP of 6.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[5-(2,2-dibromoethenyl)-4-iodo-2-(methoxymethoxy)phenoxy]-dimethylsilane is sourced from PubChem (CID 53255459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).