About [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol
[(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol (PubChem CID 5325606) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol |
| PubChem CID | 5325606 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol |
| SMILES | CC1=CO[C@H](CO)CC1 |
| InChI | InChI=1S/C7H12O2/c1-6-2-3-7(4-8)9-5-6/h5,7-8H,2-4H2,1H3/t7-/m0/s1 |
| InChIKey | TVATZMPTDCUELD-ZETCQYMHSA-N |
| XLogP | 1.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol?
The IUPAC name of [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol (CID 5325606) is [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol.
What is the SMILES notation for [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol?
The canonical SMILES for [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol is CC1=CO[C@H](CO)CC1.
What is the InChIKey of [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol?
The InChIKey is TVATZMPTDCUELD-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H12O2/c1-6-2-3-7(4-8)9-5-6/h5,7-8H,2-4H2,1H3/t7-/m0/s1.
What are the key properties of [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol?
[(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol has a molecular weight of 128.17 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-methyl-3,4-dihydro-2H-pyran-2-yl]methanol is sourced from PubChem (CID 5325606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).