About 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile
2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile (PubChem CID 53256590) has the molecular formula C8H2F6N2O
and a molecular weight of 256.11 g/mol. Its IUPAC name is 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile |
| PubChem CID | 53256590 |
| Molecular Formula | C8H2F6N2O |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C8H2F6N2O/c9-7(10,11)4-1-5(8(12,13)14)16-6(17)3(4)2-15/h1H,(H,16,17) |
| InChIKey | DGJXLZTURIWFSZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile?
The IUPAC name of 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile (CID 53256590) is 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile.
What is the SMILES notation for 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile?
The canonical SMILES for 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile is N#Cc1c(C(F)(F)F)cc(C(F)(F)F)[nH]c1=O.
What is the InChIKey of 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile?
The InChIKey is DGJXLZTURIWFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2F6N2O/c9-7(10,11)4-1-5(8(12,13)14)16-6(17)3(4)2-15/h1H,(H,16,17).
What are the key properties of 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile?
2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile has a molecular weight of 256.11 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile is sourced from PubChem (CID 53256590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).