C18H21N7S — CID 53257094
N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyrimidin-6-ylpiperazine-1-carbothioamide (PubChem CID 53257094) has the molecular formula C18H21N7S and a molecular weight of 367.48 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyrimidin-6-ylpiperazine-1-carbothioamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyrimidin-6-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257094 |
| Molecular Formula | C18H21N7S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyrimidin-6-ylpiperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(c3cnc4nccn4c3)CC2)c1 |
| InChI | InChI=1S/C18H21N7S/c1-13-9-14(2)21-16(10-13)22-18(26)24-7-5-23(6-8-24)15-11-20-17-19-3-4-25(17)12-15/h3-4,9-12H,5-8H2,1-2H3,(H,21,22,26) |
| InChIKey | DHLKSIFJDSXEKL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|