C19H22N6S — CID 53257115
N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyridin-5-ylpiperazine-1-carbothioamide (PubChem CID 53257115) has the molecular formula C19H22N6S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyridin-5-ylpiperazine-1-carbothioamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyridin-5-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257115 |
| Molecular Formula | C19H22N6S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-imidazo[1,2-a]pyridin-5-ylpiperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(c3cccc4nccn34)CC2)c1 |
| InChI | InChI=1S/C19H22N6S/c1-14-12-15(2)21-16(13-14)22-19(26)24-10-8-23(9-11-24)18-5-3-4-17-20-6-7-25(17)18/h3-7,12-13H,8-11H2,1-2H3,(H,21,22,26) |
| InChIKey | IWXWUUPJGXUIHH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|