C10H13NO — CID 5325714
3-ethyl-2,5,6,7-tetrahydrocyclopenta[c]pyridin-1-one (PubChem CID 5325714) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-ethyl-2,5,6,7-tetrahydrocyclopenta[c]pyridin-1-one.
| Compound Name | 3-ethyl-2,5,6,7-tetrahydrocyclopenta[c]pyridin-1-one |
|---|---|
| PubChem CID | 5325714 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-ethyl-2,5,6,7-tetrahydrocyclopenta[c]pyridin-1-one |
| SMILES | CCc1cc2c(c(=O)[nH]1)CCC2 |
| InChI | InChI=1S/C10H13NO/c1-2-8-6-7-4-3-5-9(7)10(12)11-8/h6H,2-5H2,1H3,(H,11,12) |
| InChIKey | MQXWNNGYCYSWQS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |