About N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide
N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide (PubChem CID 53257164) has the molecular formula C20H24N6S
and a molecular weight of 380.52 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide.
Molecular Properties
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide |
| PubChem CID | 53257164 |
| Molecular Formula | C20H24N6S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(c3ccc4cn(C)nc4c3)CC2)c1 |
| InChI | InChI=1S/C20H24N6S/c1-14-10-15(2)21-19(11-14)22-20(27)26-8-6-25(7-9-26)17-5-4-16-13-24(3)23-18(16)12-17/h4-5,10-13H,6-9H2,1-3H3,(H,21,22,27) |
| InChIKey | QKIYTKYAJHCFQE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide?
The IUPAC name of N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide (CID 53257164) is N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide.
What is the SMILES notation for N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide?
The canonical SMILES for N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide is Cc1cc(C)nc(NC(=S)N2CCN(c3ccc4cn(C)nc4c3)CC2)c1.
What is the InChIKey of N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide?
The InChIKey is QKIYTKYAJHCFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6S/c1-14-10-15(2)21-19(11-14)22-20(27)26-8-6-25(7-9-26)17-5-4-16-13-24(3)23-18(16)12-17/h4-5,10-13H,6-9H2,1-3H3,(H,21,22,27).
What are the key properties of N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide?
N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide has a molecular weight of 380.52 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethyl-2-pyridinyl)-4-(2-methylindazol-6-yl)piperazine-1-carbothioamide is sourced from PubChem (CID 53257164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).