C18H19Cl3N4S — CID 53257198
N-(4,6-dimethyl-2-pyridinyl)-4-(2,3,4-trichlorophenyl)piperazine-1-carbothioamide (PubChem CID 53257198) has the molecular formula C18H19Cl3N4S and a molecular weight of 429.80 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-(2,3,4-trichlorophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-(2,3,4-trichlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257198 |
| Molecular Formula | C18H19Cl3N4S |
| Molecular Weight | 429.80 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-(2,3,4-trichlorophenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cc(C)nc(NC(=S)N2CCN(c3ccc(Cl)c(Cl)c3Cl)CC2)c1 |
| InChI | InChI=1S/C18H19Cl3N4S/c1-11-9-12(2)22-15(10-11)23-18(26)25-7-5-24(6-8-25)14-4-3-13(19)16(20)17(14)21/h3-4,9-10H,5-8H2,1-2H3,(H,22,23,26) |
| InChIKey | WKFUYRNUGCILSS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|