About 6-methylpyrrolo[3,4-b]pyridine-5,7-dione
6-methylpyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 5325721) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 6-methylpyrrolo[3,4-b]pyridine-5,7-dione.
Molecular Properties
| Compound Name | 6-methylpyrrolo[3,4-b]pyridine-5,7-dione |
| PubChem CID | 5325721 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 6-methylpyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C8H6N2O2/c1-10-7(11)5-3-2-4-9-6(5)8(10)12/h2-4H,1H3 |
| InChIKey | LKYINPYNYHIZKR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-methylpyrrolo[3,4-b]pyridine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyrrolo[3,4-b]pyridine-5,7-dione?
The IUPAC name of 6-methylpyrrolo[3,4-b]pyridine-5,7-dione (CID 5325721) is 6-methylpyrrolo[3,4-b]pyridine-5,7-dione.
What is the SMILES notation for 6-methylpyrrolo[3,4-b]pyridine-5,7-dione?
The canonical SMILES for 6-methylpyrrolo[3,4-b]pyridine-5,7-dione is CN1C(=O)c2cccnc2C1=O.
What is the InChIKey of 6-methylpyrrolo[3,4-b]pyridine-5,7-dione?
The InChIKey is LKYINPYNYHIZKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c1-10-7(11)5-3-2-4-9-6(5)8(10)12/h2-4H,1H3.
What are the key properties of 6-methylpyrrolo[3,4-b]pyridine-5,7-dione?
6-methylpyrrolo[3,4-b]pyridine-5,7-dione has a molecular weight of 162.15 g/mol, XLogP of 0.31, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyrrolo[3,4-b]pyridine-5,7-dione is sourced from PubChem (CID 5325721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).