C15H23NO3 — CID 53257423
(2Z)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)-N-methylacetamide (PubChem CID 53257423) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (2Z)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)-N-methylacetamide.
| Compound Name | (2Z)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 53257423 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (2Z)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)-N-methylacetamide |
| SMILES | CN(CCO)C(=O)/C=C1/CC[C@@H]2CCCC(=O)[C@H]2C1 |
| InChI | InChI=1S/C15H23NO3/c1-16(7-8-17)15(19)10-11-5-6-12-3-2-4-14(18)13(12)9-11/h10,12-13,17H,2-9H2,1H3/b11-10-/t12-,13-/m0/s1 |
| InChIKey | BSMVYECMNSJMGQ-XOFVUTBISA-N |
| XLogP | 1.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|