About (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one
(5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one (PubChem CID 5325744) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one.
Molecular Properties
| Compound Name | (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one |
| PubChem CID | 5325744 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one |
| SMILES | C/C=C1\C=CC2=C1C(=O)CCN2 |
| InChI | InChI=1S/C10H11NO/c1-2-7-3-4-8-10(7)9(12)5-6-11-8/h2-4,11H,5-6H2,1H3/b7-2+ |
| InChIKey | GPMLOKDWIQLIST-FARCUNLSSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
The IUPAC name of (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one (CID 5325744) is (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one.
What is the SMILES notation for (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
The canonical SMILES for (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one is C/C=C1\C=CC2=C1C(=O)CCN2.
What is the InChIKey of (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
The InChIKey is GPMLOKDWIQLIST-FARCUNLSSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-7-3-4-8-10(7)9(12)5-6-11-8/h2-4,11H,5-6H2,1H3/b7-2+.
What are the key properties of (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
(5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one has a molecular weight of 161.20 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one is sourced from PubChem (CID 5325744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).