About 3,5-dimethyl-4-phenyl-1,2-oxazole
3,5-dimethyl-4-phenyl-1,2-oxazole (PubChem CID 5325760) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3,5-dimethyl-4-phenyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-phenyl-1,2-oxazole |
| PubChem CID | 5325760 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3,5-dimethyl-4-phenyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C11H11NO/c1-8-11(9(2)13-12-8)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | BHAXDAUULXCVEK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-4-phenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-phenyl-1,2-oxazole?
The IUPAC name of 3,5-dimethyl-4-phenyl-1,2-oxazole (CID 5325760) is 3,5-dimethyl-4-phenyl-1,2-oxazole.
What is the SMILES notation for 3,5-dimethyl-4-phenyl-1,2-oxazole?
The canonical SMILES for 3,5-dimethyl-4-phenyl-1,2-oxazole is Cc1noc(C)c1-c1ccccc1.
What is the InChIKey of 3,5-dimethyl-4-phenyl-1,2-oxazole?
The InChIKey is BHAXDAUULXCVEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-8-11(9(2)13-12-8)10-6-4-3-5-7-10/h3-7H,1-2H3.
What are the key properties of 3,5-dimethyl-4-phenyl-1,2-oxazole?
3,5-dimethyl-4-phenyl-1,2-oxazole has a molecular weight of 173.21 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-phenyl-1,2-oxazole is sourced from PubChem (CID 5325760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).