C19H20ClF3N6O4 — CID 53257783
(1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate;2,2,2-trifluoroacetate (PubChem CID 53257783) has the molecular formula C19H20ClF3N6O4 and a molecular weight of 488.85 g/mol. Its IUPAC name is (1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate;2,2,2-trifluoroacetate.
| Compound Name | (1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 53257783 |
| Molecular Formula | C19H20ClF3N6O4 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate;2,2,2-trifluoroacetate |
| SMILES | CCn1c(COC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccccc21.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C17H19ClN6O2.C2HF3O2/c1-3-23-10-7-5-6-8-11(10)24(4-2)12(23)9-26-17(25)13-15(19)22-16(20)14(18)21-13;3-2(4,5)1(6)7/h5-8H,3-4,9H2,1-2H3,(H3-,19,20,22,25);(H,6,7) |
| InChIKey | QCPWJFJFYBVFTH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|