C29H39N3O2 — CID 53257965
N,N-diethyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-9-yl)methyl]benzamide (PubChem CID 53257965) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N,N-diethyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-9-yl)methyl]benzamide.
| Compound Name | N,N-diethyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-9-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53257965 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | N,N-diethyl-4-[(3-methoxyphenyl)-(3-prop-2-enyl-3,9-diazabicyclo[3.3.1]nonan-9-yl)methyl]benzamide |
| SMILES | C=CCN1CC2CCCC(C1)N2C(c1ccc(C(=O)N(CC)CC)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C29H39N3O2/c1-5-18-30-20-25-11-9-12-26(21-30)32(25)28(24-10-8-13-27(19-24)34-4)22-14-16-23(17-15-22)29(33)31(6-2)7-3/h5,8,10,13-17,19,25-26,28H,1,6-7,9,11-12,18,20-21H2,2-4H3 |
| InChIKey | URMGLCMETFBNDV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|