About 9-prop-2-enylpyrido[3,4-b]indole
9-prop-2-enylpyrido[3,4-b]indole (PubChem CID 53258041) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 9-prop-2-enylpyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 9-prop-2-enylpyrido[3,4-b]indole |
| PubChem CID | 53258041 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 9-prop-2-enylpyrido[3,4-b]indole |
| SMILES | C=CCn1c2ccccc2c2ccncc21 |
| InChI | InChI=1S/C14H12N2/c1-2-9-16-13-6-4-3-5-11(13)12-7-8-15-10-14(12)16/h2-8,10H,1,9H2 |
| InChIKey | IWZMOPHWKSCRGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-prop-2-enylpyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-prop-2-enylpyrido[3,4-b]indole?
The IUPAC name of 9-prop-2-enylpyrido[3,4-b]indole (CID 53258041) is 9-prop-2-enylpyrido[3,4-b]indole.
What is the SMILES notation for 9-prop-2-enylpyrido[3,4-b]indole?
The canonical SMILES for 9-prop-2-enylpyrido[3,4-b]indole is C=CCn1c2ccccc2c2ccncc21.
What is the InChIKey of 9-prop-2-enylpyrido[3,4-b]indole?
The InChIKey is IWZMOPHWKSCRGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-2-9-16-13-6-4-3-5-11(13)12-7-8-15-10-14(12)16/h2-8,10H,1,9H2.
What are the key properties of 9-prop-2-enylpyrido[3,4-b]indole?
9-prop-2-enylpyrido[3,4-b]indole has a molecular weight of 208.26 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-prop-2-enylpyrido[3,4-b]indole is sourced from PubChem (CID 53258041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).