C27H33N3O2 — CID 53258065
4-[(3-hydroxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]-N,N-dimethylbenzamide (PubChem CID 53258065) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 4-[(3-hydroxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(3-hydroxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 53258065 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 4-[(3-hydroxyphenyl)-(10-prop-2-enyl-9,10-diazatricyclo[4.2.1.12,5]decan-9-yl)methyl]-N,N-dimethylbenzamide |
| SMILES | C=CCN1C2CCC1C1CCC2N1C(c1ccc(C(=O)N(C)C)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C27H33N3O2/c1-4-16-29-22-12-13-23(29)25-15-14-24(22)30(25)26(20-6-5-7-21(31)17-20)18-8-10-19(11-9-18)27(32)28(2)3/h4-11,17,22-26,31H,1,12-16H2,2-3H3 |
| InChIKey | UPBJMUAOAAEUPW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|