C27H39N7O5 — CID 53258197
[2-[[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carbonyl]amino]-5-[[amino(nitramido)methylidene]amino]pentyl] butanoate (PubChem CID 53258197) has the molecular formula C27H39N7O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is [2-[[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carbonyl]amino]-5-[[amino(nitramido)methylidene]amino]pentyl] butanoate.
| Compound Name | [2-[[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carbonyl]amino]-5-[[amino(nitramido)methylidene]amino]pentyl] butanoate |
|---|---|
| PubChem CID | 53258197 |
| Molecular Formula | C27H39N7O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | [2-[[(6aR,9R,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carbonyl]amino]-5-[[amino(nitramido)methylidene]amino]pentyl] butanoate |
| SMILES | CCCC(=O)OCC(CCC/N=C(\N)N[N+](=O)[O-])NC(=O)[C@@H]1C[C@@H]2c3cccc4c3c(cn4C)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C27H39N7O5/c1-4-7-24(35)39-16-19(8-6-11-29-27(28)31-34(37)38)30-26(36)18-12-21-20-9-5-10-22-25(20)17(14-32(22)2)13-23(21)33(3)15-18/h5,9-10,14,18-19,21,23H,4,6-8,11-13,15-16H2,1-3H3,(H,30,36)(H3,28,29,31)/t18-,19?,21-,23-/m1/s1 |
| InChIKey | DYFQXPKACYBCCC-BHAPBFLFSA-N |
| XLogP | 1.84 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|