About N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide
N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide (PubChem CID 53258388) has the molecular formula C24H37N3OS
and a molecular weight of 415.65 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 53258388 |
| Molecular Formula | C24H37N3OS |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCn1c(CC(=O)NC23CC4CC(CC(C4)C2)C3)cs/c1=N\C1CCCCCC1 |
| InChI | InChI=1S/C24H37N3OS/c1-2-27-21(16-29-23(27)25-20-7-5-3-4-6-8-20)12-22(28)26-24-13-17-9-18(14-24)11-19(10-17)15-24/h16-20H,2-15H2,1H3,(H,26,28)/b25-23- |
| InChIKey | UGABNMUBDAPIJR-BZZOAKBMSA-N |
| XLogP | 4.82 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide (CID 53258388) is N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide is CCn1c(CC(=O)NC23CC4CC(CC(C4)C2)C3)cs/c1=N\C1CCCCCC1.
What is the InChIKey of N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide?
The InChIKey is UGABNMUBDAPIJR-BZZOAKBMSA-N. The full InChI is InChI=1S/C24H37N3OS/c1-2-27-21(16-29-23(27)25-20-7-5-3-4-6-8-20)12-22(28)26-24-13-17-9-18(14-24)11-19(10-17)15-24/h16-20H,2-15H2,1H3,(H,26,28)/b25-23-.
What are the key properties of N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide?
N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide has a molecular weight of 415.65 g/mol, XLogP of 4.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-2-(2-cycloheptylimino-3-ethyl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 53258388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).