About (4S,5S)-4,5-dibromocyclohexene
(4S,5S)-4,5-dibromocyclohexene (PubChem CID 5325851) has the molecular formula C6H8Br2
and a molecular weight of 239.94 g/mol. Its IUPAC name is (4S,5S)-4,5-dibromocyclohexene.
Molecular Properties
| Compound Name | (4S,5S)-4,5-dibromocyclohexene |
| PubChem CID | 5325851 |
| Molecular Formula | C6H8Br2 |
| Molecular Weight | 239.94 g/mol |
| Exact Mass | 237.90 |
| IUPAC Name | (4S,5S)-4,5-dibromocyclohexene |
| SMILES | Br[C@H]1CC=CC[C@@H]1Br |
| InChI | InChI=1S/C6H8Br2/c7-5-3-1-2-4-6(5)8/h1-2,5-6H,3-4H2/t5-,6-/m0/s1 |
| InChIKey | AAJZFOGMZOTJFE-WDSKDSINSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.94 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-4,5-dibromocyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4,5-dibromocyclohexene?
The IUPAC name of (4S,5S)-4,5-dibromocyclohexene (CID 5325851) is (4S,5S)-4,5-dibromocyclohexene.
What is the SMILES notation for (4S,5S)-4,5-dibromocyclohexene?
The canonical SMILES for (4S,5S)-4,5-dibromocyclohexene is Br[C@H]1CC=CC[C@@H]1Br.
What is the InChIKey of (4S,5S)-4,5-dibromocyclohexene?
The InChIKey is AAJZFOGMZOTJFE-WDSKDSINSA-N. The full InChI is InChI=1S/C6H8Br2/c7-5-3-1-2-4-6(5)8/h1-2,5-6H,3-4H2/t5-,6-/m0/s1.
What are the key properties of (4S,5S)-4,5-dibromocyclohexene?
(4S,5S)-4,5-dibromocyclohexene has a molecular weight of 239.94 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4,5-dibromocyclohexene is sourced from PubChem (CID 5325851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).