C6H8O4 — CID 5325924
(3R,6R)-3,6-dimethyl-1,4-dioxane-2,5-dione (PubChem CID 5325924) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is (3R,6R)-3,6-dimethyl-1,4-dioxane-2,5-dione.
| Compound Name | (3R,6R)-3,6-dimethyl-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 5325924 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3R,6R)-3,6-dimethyl-1,4-dioxane-2,5-dione |
| SMILES | C[C@H]1OC(=O)[C@@H](C)OC1=O |
| InChI | InChI=1S/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4-/m1/s1 |
| InChIKey | JJTUDXZGHPGLLC-QWWZWVQMSA-N |
| XLogP | -0.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |