C13H21N5 — CID 53259244
N-heptyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 53259244) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-heptyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-heptyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 53259244 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-heptyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCCCNc1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C13H21N5/c1-3-4-5-6-7-8-14-12-9-11(2)17-13-15-10-16-18(12)13/h9-10,14H,3-8H2,1-2H3 |
| InChIKey | RDPQKERGSHHMJG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|