About (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene
(4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene (PubChem CID 53259839) has the molecular formula C19H32O
and a molecular weight of 276.46 g/mol. Its IUPAC name is (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene.
Molecular Properties
| Compound Name | (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene |
| PubChem CID | 53259839 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene |
| SMILES | COC1=C(CC=C(C)C)C(C)(C)[C@@H](CC=C(C)C)CC1 |
| InChI | InChI=1S/C19H32O/c1-14(2)8-10-16-11-13-18(20-7)17(19(16,5)6)12-9-15(3)4/h8-9,16H,10-13H2,1-7H3/t16-/m0/s1 |
| InChIKey | AAHSBNDDBITHAY-INIZCTEOSA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene?
The IUPAC name of (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene (CID 53259839) is (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene.
What is the SMILES notation for (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene?
The canonical SMILES for (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene is COC1=C(CC=C(C)C)C(C)(C)[C@@H](CC=C(C)C)CC1.
What is the InChIKey of (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene?
The InChIKey is AAHSBNDDBITHAY-INIZCTEOSA-N. The full InChI is InChI=1S/C19H32O/c1-14(2)8-10-16-11-13-18(20-7)17(19(16,5)6)12-9-15(3)4/h8-9,16H,10-13H2,1-7H3/t16-/m0/s1.
What are the key properties of (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene?
(4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene has a molecular weight of 276.46 g/mol, XLogP of 6.04, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-methoxy-3,3-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexene is sourced from PubChem (CID 53259839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).