C16H21N2O2+ — CID 53260202
phenyl 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylate (PubChem CID 53260202) has the molecular formula C16H21N2O2+ and a molecular weight of 273.36 g/mol. Its IUPAC name is phenyl 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylate.
| Compound Name | phenyl 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylate |
|---|---|
| PubChem CID | 53260202 |
| Molecular Formula | C16H21N2O2+ |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | phenyl 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCC[N+]2=C1CCCCC2 |
| InChI | InChI=1S/C16H21N2O2/c19-16(20-14-8-3-1-4-9-14)18-13-7-12-17-11-6-2-5-10-15(17)18/h1,3-4,8-9H,2,5-7,10-13H2/q+1 |
| InChIKey | JBUAKOJEJUUYOP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|