C23H44O5 — CID 53260300
[2-hydroxy-3-(2-hydroxyethoxy)propyl] (E)-octadec-9-enoate (PubChem CID 53260300) has the molecular formula C23H44O5 and a molecular weight of 400.60 g/mol. Its IUPAC name is [2-hydroxy-3-(2-hydroxyethoxy)propyl] (E)-octadec-9-enoate.
| Compound Name | [2-hydroxy-3-(2-hydroxyethoxy)propyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 53260300 |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | [2-hydroxy-3-(2-hydroxyethoxy)propyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(O)COCCO |
| InChI | InChI=1S/C23H44O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(26)28-21-22(25)20-27-19-18-24/h9-10,22,24-25H,2-8,11-21H2,1H3/b10-9+ |
| InChIKey | VLUCSCDQBYGJKY-MDZDMXLPSA-N |
| XLogP | 4.94 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|