C20H22F2N4S — CID 53260342
7,9-bis(4-fluorophenyl)-6,6-dimethyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione (PubChem CID 53260342) has the molecular formula C20H22F2N4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 7,9-bis(4-fluorophenyl)-6,6-dimethyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione.
| Compound Name | 7,9-bis(4-fluorophenyl)-6,6-dimethyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione |
|---|---|
| PubChem CID | 53260342 |
| Molecular Formula | C20H22F2N4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 7,9-bis(4-fluorophenyl)-6,6-dimethyl-1,2,4,8-tetrazaspiro[4.5]decane-3-thione |
| SMILES | CC1(C)C(c2ccc(F)cc2)NC(c2ccc(F)cc2)CC12NNC(=S)N2 |
| InChI | InChI=1S/C20H22F2N4S/c1-19(2)17(13-5-9-15(22)10-6-13)23-16(12-3-7-14(21)8-4-12)11-20(19)24-18(27)25-26-20/h3-10,16-17,23,26H,11H2,1-2H3,(H2,24,25,27) |
| InChIKey | ZKKSJEMWIIIKBH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|