C13H12F5NO3S — CID 53260508
(2,3,4,5,6-pentafluorophenyl)methyl N-cyclohex-2-en-1-ylsulfamate (PubChem CID 53260508) has the molecular formula C13H12F5NO3S and a molecular weight of 357.30 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl N-cyclohex-2-en-1-ylsulfamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl N-cyclohex-2-en-1-ylsulfamate |
|---|---|
| PubChem CID | 53260508 |
| Molecular Formula | C13H12F5NO3S |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl N-cyclohex-2-en-1-ylsulfamate |
| SMILES | O=S(=O)(NC1C=CCCC1)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H12F5NO3S/c14-9-8(10(15)12(17)13(18)11(9)16)6-22-23(20,21)19-7-4-2-1-3-5-7/h2,4,7,19H,1,3,5-6H2 |
| InChIKey | UFESMRJXAXOOCN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|