C9H18O3 — CID 53260656
(3R,4S)-3-methoxy-2-methylhept-6-ene-2,4-diol (PubChem CID 53260656) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (3R,4S)-3-methoxy-2-methylhept-6-ene-2,4-diol.
| Compound Name | (3R,4S)-3-methoxy-2-methylhept-6-ene-2,4-diol |
|---|---|
| PubChem CID | 53260656 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (3R,4S)-3-methoxy-2-methylhept-6-ene-2,4-diol |
| SMILES | C=CC[C@H](O)[C@@H](OC)C(C)(C)O |
| InChI | InChI=1S/C9H18O3/c1-5-6-7(10)8(12-4)9(2,3)11/h5,7-8,10-11H,1,6H2,2-4H3/t7-,8+/m0/s1 |
| InChIKey | DYFPUPPTQMJHSW-JGVFFNPUSA-N |
| XLogP | 0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|