C23H21ClN4O2 — CID 53260770
6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[2,3-h]quinazolin-4-one (PubChem CID 53260770) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[2,3-h]quinazolin-4-one.
| Compound Name | 6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[2,3-h]quinazolin-4-one |
|---|---|
| PubChem CID | 53260770 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[2,3-h]quinazolin-4-one |
| SMILES | O=c1c2cc(Cc3ccc(Cl)nc3)c3ncccc3c2ncn1[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C23H21ClN4O2/c24-20-8-7-14(12-26-20)10-15-11-17-22(16-4-3-9-25-21(15)16)27-13-28(23(17)30)18-5-1-2-6-19(18)29/h3-4,7-9,11-13,18-19,29H,1-2,5-6,10H2/t18-,19-/m0/s1 |
| InChIKey | QJKUBRWODRCJBV-OALUTQOASA-N |
| XLogP | 4.06 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|