C17H30O3Si — CID 53260830
trans-(2Z,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-(methoxymethylidene)-3-methylcyclohexan-1-one (PubChem CID 53260830) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is trans-(2Z,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-(methoxymethylidene)-3-methylcyclohexan-1-one.
| Compound Name | trans-(2Z,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-(methoxymethylidene)-3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 53260830 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | trans-(2Z,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-2-(methoxymethylidene)-3-methylcyclohexan-1-one |
| SMILES | C=C[C@@]1(C)/C(=C/OC)C(=O)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O3Si/c1-9-17(5)13(12-19-6)14(18)10-11-15(17)20-21(7,8)16(2,3)4/h9,12,15H,1,10-11H2,2-8H3/b13-12+/t15-,17-/m0/s1 |
| InChIKey | SUXLUYLKTHPFSD-FVOQVABISA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|