About N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide
N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide (PubChem CID 53260977) has the molecular formula C9H9ClF3NO2S
and a molecular weight of 287.69 g/mol. Its IUPAC name is N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide |
| PubChem CID | 53260977 |
| Molecular Formula | C9H9ClF3NO2S |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cl)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9ClF3NO2S/c1-6-2-4-7(5-3-6)17(15,16)14-8(10)9(11,12)13/h2-5,8,14H,1H3 |
| InChIKey | OENVWFFDJSWCCS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide?
The IUPAC name of N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide (CID 53260977) is N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide.
What is the SMILES notation for N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide?
The canonical SMILES for N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)NC(Cl)C(F)(F)F)cc1.
What is the InChIKey of N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide?
The InChIKey is OENVWFFDJSWCCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF3NO2S/c1-6-2-4-7(5-3-6)17(15,16)14-8(10)9(11,12)13/h2-5,8,14H,1H3.
What are the key properties of N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide?
N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide has a molecular weight of 287.69 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloro-2,2,2-trifluoroethyl)-4-methylbenzenesulfonamide is sourced from PubChem (CID 53260977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).